CAS 473918-42-2 is the registry number for 5-Nitro-1-phenyl-1H-indole, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
5-nitro-1-phenylindole (CAS 473918-42-2) is a chemical compound with the molecular formula C14H10N2O2 and a molecular weight of 238.24 g/mol. IUPAC name: 5-nitro-1-phenylindole. InChIKey: NVHTZNOEZUYKPB-UHFFFAOYSA-N.
| Molecular formula | C14H10N2O2 |
|---|---|
| Molecular weight | 238.24 g/mol |
| IUPAC name | 5-nitro-1-phenylindole |
| InChIKey | NVHTZNOEZUYKPB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C=CC3=C2C=CC(=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)