CAS 480439-30-3 is the registry number for 2,6-Dichloro-3,4-dimethoxybenzaldehyde, 97%. Offered by: AmBeed. Available pack sizes: 1g.
2,6-dichloro-3,4-dimethoxybenzaldehyde (CAS 480439-30-3) is a chemical compound with the molecular formula C9H8Cl2O3 and a molecular weight of 235.06 g/mol. IUPAC name: 2,6-dichloro-3,4-dimethoxybenzaldehyde. InChIKey: FIHJBVMZUXYWLE-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl2O3 |
|---|---|
| Molecular weight | 235.06 g/mol |
| IUPAC name | 2,6-dichloro-3,4-dimethoxybenzaldehyde |
| InChIKey | FIHJBVMZUXYWLE-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1OC)Cl)C=O)Cl |
Computed by PubChem (NCBI)