Products 480994-56-7
CAS 480994-56-7 appears in our catalog under these names: 2-(4-Formylphenoxy)-2-phenylacetic acid, 95%, 2-(4-Formylphenoxy)-2-phenylacetic acid 95%. Offered by: Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg.
2-(4-formylphenoxy)-2-phenylacetic acid (CAS 480994-56-7) is a chemical compound with the molecular formula C15H12O4 and a molecular weight of 256.25 g/mol. IUPAC name: 2-(4-formylphenoxy)-2-phenylacetic acid. InChIKey: KFWOTZCJKPDGPJ-UHFFFAOYSA-N.
| Molecular formula | C15H12O4 |
|---|---|
| Molecular weight | 256.25 g/mol |
| IUPAC name | 2-(4-formylphenoxy)-2-phenylacetic acid |
| InChIKey | KFWOTZCJKPDGPJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C(=O)O)OC2=CC=C(C=C2)C=O |
Computed by PubChem (NCBI)