CAS 4923-55-1 is the registry number for 2,5-Dihydroxynaphthalene-1,4-dione. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 0,025g.
4,5-dihydroxynaphthalene-1,2-dione (CAS 4923-55-1) is a chemical compound with the molecular formula C10H6O4 and a molecular weight of 190.15 g/mol. IUPAC name: 4,5-dihydroxynaphthalene-1,2-dione. InChIKey: AQMHLTLDUPBBEF-UHFFFAOYSA-N.
| Molecular formula | C10H6O4 |
|---|---|
| Molecular weight | 190.15 g/mol |
| IUPAC name | 4,5-dihydroxynaphthalene-1,2-dione |
| InChIKey | AQMHLTLDUPBBEF-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)O)C(=CC(=O)C2=O)O |
Computed by PubChem (NCBI)