CAS 49709-30-0 appears in our catalog under these names: 1,5-Dichloro-2-ethyl-4-nitrobenzene, 95%, 1,5-Dichloro-2-ethyl-4-nitrobenzene. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
1,5-dichloro-2-ethyl-4-nitrobenzene (CAS 49709-30-0) is a chemical compound with the molecular formula C8H7Cl2NO2 and a molecular weight of 220.05 g/mol. IUPAC name: 1,5-dichloro-2-ethyl-4-nitrobenzene. InChIKey: MXQNFFXTXXKFEP-UHFFFAOYSA-N.
| Molecular formula | C8H7Cl2NO2 |
|---|---|
| Molecular weight | 220.05 g/mol |
| IUPAC name | 1,5-dichloro-2-ethyl-4-nitrobenzene |
| InChIKey | MXQNFFXTXXKFEP-UHFFFAOYSA-N |
| SMILES | CCC1=CC(=C(C=C1Cl)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)