Products 4972-11-6
CAS 4972-11-6 is the registry number for 1-Hydroxy-2,2,6,6-tetramethyl-4-hydroxypiperidinium Chloride. Offered by: TRC. Available pack sizes: 50mg.
1-hydroxy-2,2,6,6-tetramethylpiperidin-4-ol;hydrochloride (CAS 4972-11-6) is a chemical compound with the molecular formula C9H20ClNO2 and a molecular weight of 209.71 g/mol. IUPAC name: 1-hydroxy-2,2,6,6-tetramethylpiperidin-4-ol;hydrochloride. InChIKey: QCJDXHSSMDQRBO-UHFFFAOYSA-N.
| Molecular formula | C9H20ClNO2 |
|---|---|
| Molecular weight | 209.71 g/mol |
| IUPAC name | 1-hydroxy-2,2,6,6-tetramethylpiperidin-4-ol;hydrochloride |
| InChIKey | QCJDXHSSMDQRBO-UHFFFAOYSA-N |
| SMILES | CC1(CC(CC(N1O)(C)C)O)C.Cl |
Computed by PubChem (NCBI)