Products 49850-62-6

CAS 49850-62-6 appears in our catalog under these names: 1,5-Naphthyridine-2-carboxylic acid, 97%, 1,5-Naphthyridine-2-carboxylic acid, 95+%, 1,5-Naphthyridine-2-carboxylic acid, 1,5-Naphthyridine-2-carboxylic acid, 95%, 95%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 10g, 5g, 2,5g, 100mg.

Structural formula: {0} (CAS {1})

1,5-naphthyridine-2-carboxylic acid (CAS 49850-62-6) is a chemical compound with the molecular formula C9H6N2O2 and a molecular weight of 174.16 g/mol. IUPAC name: 1,5-naphthyridine-2-carboxylic acid. InChIKey: XCFUFRWRMISKRZ-UHFFFAOYSA-N.

Identity
Molecular formulaC9H6N2O2
Molecular weight174.16 g/mol
IUPAC name1,5-naphthyridine-2-carboxylic acid
InChIKeyXCFUFRWRMISKRZ-UHFFFAOYSA-N
SMILESC1=CC2=C(C=CC(=N2)C(=O)O)N=C1

Computed by PubChem (NCBI)