CAS 499-49-0 appears in our catalog under these names: 5–Methylisophthalic acid, 5-Methylisophthalic acid, 98% , 5-Methylisophthalic Acid, >98.0%(GC)(T), 5-Methylisophthalic acid 97%, 5-METHYLISOPHTHALIC ACID, 97%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), TCI, Ambeed, Sigma-Aldrich. Available pack sizes: 100g, 250g, 1g, 5g, 25g, 10g, 500g, 1000g.
5-methylbenzene-1,3-dicarboxylic acid (CAS 499-49-0) is a chemical compound with the molecular formula C9H8O4 and a molecular weight of 180.16 g/mol. IUPAC name: 5-methylbenzene-1,3-dicarboxylic acid. InChIKey: PMZBHPUNQNKBOA-UHFFFAOYSA-N.
| Molecular formula | C9H8O4 |
|---|---|
| Molecular weight | 180.16 g/mol |
| IUPAC name | 5-methylbenzene-1,3-dicarboxylic acid |
| InChIKey | PMZBHPUNQNKBOA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)