Products 499977-24-1
CAS 499977-24-1 appears in our catalog under these names: (R)-3-Amino-3-(naphthalen-1-yl)propanoic acid hydrochloride, 95%, (R)-3-Amino-3-(naphthalen-1-yl)propanoic acid hydrochloride, 97%, (R)–3–Amino–3–(naphthalen–1–yl)propanoic acid hydrochloride, (R)-3-amino-3-(naphthalen-1-yl)propanoic acid hydrochloride, (R)-3-AMINO-3-(NAPHTHALEN-1-YL)PROPANOIC ACID HCL, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth, Chemat. Available pack sizes: 10g, 5g, 1g, 250mg.
(3R)-3-amino-3-naphthalen-1-ylpropanoic acid;hydrochloride (CAS 499977-24-1) is a chemical compound with the molecular formula C13H14ClNO2 and a molecular weight of 251.71 g/mol. IUPAC name: (3R)-3-amino-3-naphthalen-1-ylpropanoic acid;hydrochloride. InChIKey: VUJZYACELDPKDE-UTONKHPSSA-N.
| Molecular formula | C13H14ClNO2 |
|---|---|
| Molecular weight | 251.71 g/mol |
| IUPAC name | (3R)-3-amino-3-naphthalen-1-ylpropanoic acid;hydrochloride |
| InChIKey | VUJZYACELDPKDE-UTONKHPSSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2[C@@H](CC(=O)O)N.Cl |
Computed by PubChem (NCBI)