CAS 500695-97-6 appears in our catalog under these names: 2–Amino–2–(2,5–dichlorophenyl)acetic acid, 2-Amino-2-(2,5-dichlorophenyl)acetic acid, H-DL-2-(2,5-DiCl-Phenyl)-Gly-OH 95%, 2-Amino-2-(2,5-dichlorophenyl)acetic acid, 95%, 95%, 2-Amino-2-(2,5-dichlorophenyl)acetic acid, 97%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 2,5g, 5g.
2-amino-2-(2,5-dichlorophenyl)acetic acid (CAS 500695-97-6) is a chemical compound with the molecular formula C8H7Cl2NO2 and a molecular weight of 220.05 g/mol. IUPAC name: 2-amino-2-(2,5-dichlorophenyl)acetic acid. InChIKey: GIXVDSMZGIUWPA-UHFFFAOYSA-N.
| Molecular formula | C8H7Cl2NO2 |
|---|---|
| Molecular weight | 220.05 g/mol |
| IUPAC name | 2-amino-2-(2,5-dichlorophenyl)acetic acid |
| InChIKey | GIXVDSMZGIUWPA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C(C(=O)O)N)Cl |
Computed by PubChem (NCBI)