CAS 51336-94-8 appears in our catalog under these names: Fluconazole Impurity 6 (2-Chloro-2’,4’-Difluoroacetophenone), 2-Chloro-2',4'-difluoroacetophenone, >95% (HPLC), 2-Chloro-2',4'-difluoroacetophenone, 2–Chloro–2',4'–difluoroacetophenone, 2-Chloro-2',4'-difluoroacetophenone, 98% . Offered by: Chemat Brand, TRC, Mikromol, GLPBio, Thermo Scientific (Alfa Aesar). Available pack sizes: on request, 25g, 4x25mg, 25mg, 100mg, 100g, 5g, 1kg.
2-chloro-1-(2,4-difluorophenyl)ethanone (CAS 51336-94-8) is a chemical compound with the molecular formula C8H5ClF2O and a molecular weight of 190.57 g/mol. IUPAC name: 2-chloro-1-(2,4-difluorophenyl)ethanone. InChIKey: UENGBOCGGKLVJJ-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF2O |
|---|---|
| Molecular weight | 190.57 g/mol |
| IUPAC name | 2-chloro-1-(2,4-difluorophenyl)ethanone |
| InChIKey | UENGBOCGGKLVJJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)F)C(=O)CCl |
Computed by PubChem (NCBI)