Products 51362-47-1

CAS 51362-47-1 is the registry number for 6-(p-tolyloxy)nicotinic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

6-(4-methylphenoxy)pyridine-3-carboxylic acid (CAS 51362-47-1) is a chemical compound with the molecular formula C13H11NO3 and a molecular weight of 229.23 g/mol. IUPAC name: 6-(4-methylphenoxy)pyridine-3-carboxylic acid. InChIKey: FPMLCPIDLYKONR-UHFFFAOYSA-N.

Identity
Molecular formulaC13H11NO3
Molecular weight229.23 g/mol
IUPAC name6-(4-methylphenoxy)pyridine-3-carboxylic acid
InChIKeyFPMLCPIDLYKONR-UHFFFAOYSA-N
SMILESCC1=CC=C(C=C1)OC2=NC=C(C=C2)C(=O)O

Computed by PubChem (NCBI)