CAS 518070-24-1 appears in our catalog under these names: 2-Cyano-5-fluorobenzoic acid, 95%, 2-Cyano-5-fluorobenzoic acid, 2-Cyano-5-fluorobenzoic acid 95%, 2-Cyano-5-fluorobenzoic acid, 95%, 95%, 2-Cyano-5-fluorobenzoic acid, 97%,RG. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 1000mg, 500mg, 2000mg, 5000mg, 10000mg, 250mg, 1g.
2-cyano-5-fluorobenzoic acid (CAS 518070-24-1) is a chemical compound with the molecular formula C8H4FNO2 and a molecular weight of 165.12 g/mol. IUPAC name: 2-cyano-5-fluorobenzoic acid. InChIKey: MUQWLBDSRBARGV-UHFFFAOYSA-N.
| Molecular formula | C8H4FNO2 |
|---|---|
| Molecular weight | 165.12 g/mol |
| IUPAC name | 2-cyano-5-fluorobenzoic acid |
| InChIKey | MUQWLBDSRBARGV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)C(=O)O)C#N |
Computed by PubChem (NCBI)