Products 52651-16-8
CAS 52651-16-8 appears in our catalog under these names: 6-Bromo-2,3-dihydro-1H-indene-1-carboxylic acid, 6-Bromo-2,3-dihydro-1H-indene-1-carboxylic acid, 97%, 6-Bromo-2，3-dihydro-1H-indene-1-carboxylic acid, 97%. Offered by: Biosynth, Ambeed, BLDpharm, Fluorochem, Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g, 10g.
6-bromo-2,3-dihydro-1H-indene-1-carboxylic acid (CAS 52651-16-8) is a chemical compound with the molecular formula C10H9BrO2 and a molecular weight of 241.08 g/mol. IUPAC name: 6-bromo-2,3-dihydro-1H-indene-1-carboxylic acid. InChIKey: RMVRCSOJMLGDAG-UHFFFAOYSA-N.
| Molecular formula | C10H9BrO2 |
|---|---|
| Molecular weight | 241.08 g/mol |
| IUPAC name | 6-bromo-2,3-dihydro-1H-indene-1-carboxylic acid |
| InChIKey | RMVRCSOJMLGDAG-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1C(=O)O)C=C(C=C2)Br |
Computed by PubChem (NCBI)