CAS 52980-27-5 appears in our catalog under these names: 8-Chloro-4-oxo-1,4-dihydro-quinoline-3-carboxylic acid ethyl ester, 97%, 8-Chloro-4-oxo-1,4-dihydro-quinoline-3-carboxylic acid ethyl ester, 95%, 95%, 8-Chloro-4-oxo-1,4-dihydro-quinoline-3-carboxylic acid ethyl ester, 95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg, 10g, 25g.
Ethyl 8-chloro-4-oxo-1H-quinoline-3-carboxylate (CAS 52980-27-5) is a chemical compound with the molecular formula C12H10ClNO3 and a molecular weight of 251.66 g/mol. IUPAC name: ethyl 8-chloro-4-oxo-1H-quinoline-3-carboxylate. InChIKey: CVTZGJPEFPRNNB-UHFFFAOYSA-N.
| Molecular formula | C12H10ClNO3 |
|---|---|
| Molecular weight | 251.66 g/mol |
| IUPAC name | ethyl 8-chloro-4-oxo-1H-quinoline-3-carboxylate |
| InChIKey | CVTZGJPEFPRNNB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CNC2=C(C1=O)C=CC=C2Cl |
Computed by PubChem (NCBI)