Products 53066-25-4
CAS 53066-25-4 is the registry number for methyl 3,6-dichloro-2-hydroxybenzoate, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
Methyl 3,6-dichloro-2-hydroxybenzoate (CAS 53066-25-4) is a chemical compound with the molecular formula C8H6Cl2O3 and a molecular weight of 221.03 g/mol. IUPAC name: methyl 3,6-dichloro-2-hydroxybenzoate. InChIKey: RWVAEQFJDGZLEO-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2O3 |
|---|---|
| Molecular weight | 221.03 g/mol |
| IUPAC name | methyl 3,6-dichloro-2-hydroxybenzoate |
| InChIKey | RWVAEQFJDGZLEO-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1O)Cl)Cl |
Computed by PubChem (NCBI)