CAS 5374-19-6 appears in our catalog under these names: (S)-1,3,4,6,7,11B-hexahydro-2H-pyrazino[2,1-a]isoquinoline dihydrochloride, 98%, 98%, (S)-2,3,4,6,7,11b-hexahydro-1H-pyrazino[2,1-a]isoquinoline dihydrochloride, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
(11bS)-2,3,4,6,7,11b-hexahydro-1H-pyrazino[2,1-a]isoquinoline;dihydrochloride (CAS 5374-19-6) is a chemical compound with the molecular formula C12H18Cl2N2 and a molecular weight of 261.19 g/mol. IUPAC name: (11bS)-2,3,4,6,7,11b-hexahydro-1H-pyrazino[2,1-a]isoquinoline;dihydrochloride. InChIKey: WPASCARMJJLMHJ-CURYUGHLSA-N.
| Molecular formula | C12H18Cl2N2 |
|---|---|
| Molecular weight | 261.19 g/mol |
| IUPAC name | (11bS)-2,3,4,6,7,11b-hexahydro-1H-pyrazino[2,1-a]isoquinoline;dihydrochloride |
| InChIKey | WPASCARMJJLMHJ-CURYUGHLSA-N |
| SMILES | C1CN2CCNC[C@@H]2C3=CC=CC=C31.Cl.Cl |
Computed by PubChem (NCBI)