Products 531508-36-8
CAS 531508-36-8 is the registry number for 4-(2-Bromoethyl)-2,2-difluoro-1,3-dioxaindane. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-(2-bromoethyl)-2,2-difluoro-1,3-benzodioxole (CAS 531508-36-8) is a chemical compound with the molecular formula C9H7BrF2O2 and a molecular weight of 265.05 g/mol. IUPAC name: 4-(2-bromoethyl)-2,2-difluoro-1,3-benzodioxole. InChIKey: JYEQNJYUQHXXBG-UHFFFAOYSA-N.
| Molecular formula | C9H7BrF2O2 |
|---|---|
| Molecular weight | 265.05 g/mol |
| IUPAC name | 4-(2-bromoethyl)-2,2-difluoro-1,3-benzodioxole |
| InChIKey | JYEQNJYUQHXXBG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1)OC(O2)(F)F)CCBr |
Computed by PubChem (NCBI)