Products 53518-98-2
CAS 53518-98-2 appears in our catalog under these names: N-Benzoyl-d5-glycine, 98 atom % D, min 98% Chemical Purity, Hippuric Acid-d5, >95% (HPLC), Hippuric acid–d5, Hippuric acid-d5, 99.65%. Offered by: CDN, TRC, GLPBio, MedChemExpress. Available pack sizes: 0,25g, 0,1g, 100mg, 10mg, 10 mg, 5 mg, 1 mg.
2-[(2,3,4,5,6-pentadeuteriobenzoyl)amino]acetic acid (CAS 53518-98-2) is a chemical compound with the molecular formula C9H9NO3 and a molecular weight of 184.20 g/mol. IUPAC name: 2-[(2,3,4,5,6-pentadeuteriobenzoyl)amino]acetic acid. InChIKey: QIAFMBKCNZACKA-RALIUCGRSA-N.
| Molecular formula | C9H9NO3 |
|---|---|
| Molecular weight | 184.20 g/mol |
| IUPAC name | 2-[(2,3,4,5,6-pentadeuteriobenzoyl)amino]acetic acid |
| InChIKey | QIAFMBKCNZACKA-RALIUCGRSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C(=O)NCC(=O)O)[2H])[2H] |
Computed by PubChem (NCBI)