Products 93627-88-4
CAS 93627-88-4 is the registry number for Hippuric acid-15N. Offered by: MedChemExpress. Available pack sizes: 5mg, 1mg.
2-(benzoyl(15N)amino)acetic acid (CAS 93627-88-4) is a chemical compound with the molecular formula C9H9NO3 and a molecular weight of 180.17 g/mol. IUPAC name: 2-(benzoyl(15N)amino)acetic acid. InChIKey: QIAFMBKCNZACKA-DETAZLGJSA-N.
| Molecular formula | C9H9NO3 |
|---|---|
| Molecular weight | 180.17 g/mol |
| IUPAC name | 2-(benzoyl(15N)amino)acetic acid |
| InChIKey | QIAFMBKCNZACKA-DETAZLGJSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)[15NH]CC(=O)O |
Computed by PubChem (NCBI)