Products 53534-83-1
CAS 53534-83-1 is the registry number for 2,5-Dideoxystreptamine dihydrochloride. Offered by: Biosynth. Available pack sizes: 5000mg, 2000mg.
(1R,3S,4S,6R)-4,6-diaminocyclohexane-1,3-diol;dihydrochloride (CAS 53534-83-1) is a chemical compound with the molecular formula C6H16Cl2N2O2 and a molecular weight of 219.11 g/mol. IUPAC name: (1R,3S,4S,6R)-4,6-diaminocyclohexane-1,3-diol;dihydrochloride. InChIKey: XONKGMMEZNBMPX-PXYBLNDHSA-N.
| Molecular formula | C6H16Cl2N2O2 |
|---|---|
| Molecular weight | 219.11 g/mol |
| IUPAC name | (1R,3S,4S,6R)-4,6-diaminocyclohexane-1,3-diol;dihydrochloride |
| InChIKey | XONKGMMEZNBMPX-PXYBLNDHSA-N |
| SMILES | C1[C@H]([C@@H](C[C@@H]([C@H]1N)O)O)N.Cl.Cl |
Computed by PubChem (NCBI)