Products 53890-21-4
CAS 53890-21-4 is the registry number for DL-1′-Acetoxychavicol acetate, 98.82%. Offered by: MedChemExpress. Available pack sizes: 1 mg, 5 mg.
[4-(1-acetyloxyprop-2-enyl)phenyl] acetate (CAS 53890-21-4) is a chemical compound with the molecular formula C13H14O4 and a molecular weight of 234.25 g/mol. IUPAC name: [4-(1-acetyloxyprop-2-enyl)phenyl] acetate. InChIKey: JAMQIUWGGBSIKZ-UHFFFAOYSA-N.
| Molecular formula | C13H14O4 |
|---|---|
| Molecular weight | 234.25 g/mol |
| IUPAC name | [4-(1-acetyloxyprop-2-enyl)phenyl] acetate |
| InChIKey | JAMQIUWGGBSIKZ-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC=C(C=C1)C(C=C)OC(=O)C |
Computed by PubChem (NCBI)
Synonyms:
[4-(1-acetyloxyprop-2-enyl)phenyl] acetate, (4-(1-Acetyloxyprop-2-Enyl)Phenyl) Acetate, 1'-Acetoxychavicol acetate, (+/-)-, Galangal acetate, Galangal acetate, (RS)-, Galangal acetate, (+/-)-, (+/-)-1'-acetoxychavicol acetate, [4-(1-acetoxyallyl)phenyl] acetate, Benzenemethanol, 4-(acetyloxy)-alpha-ethenyl-, 1-acetate, 1-[4-(acetyloxy)phenyl]prop-2-en-1-yl acetate