CAS 5411-50-7 appears in our catalog under these names: 1,2–Dibromo–4–nitrobenzene, 1,2-Dibromo-4-nitrobenzene, >98.0%(GC), 1,2-Dibromo-4-nitrobenzene 97%, 1,2-Dibromo-4-nitrobenzene, 97%, 97%, 3,4-Dibromonitrobenzene, 97%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 500g, 250mg, 10g, 100g.
1,2-dibromo-4-nitrobenzene (CAS 5411-50-7) is a chemical compound with the molecular formula C6H3Br2NO2 and a molecular weight of 280.90 g/mol. IUPAC name: 1,2-dibromo-4-nitrobenzene. InChIKey: DLLDRYLYVHKDKK-UHFFFAOYSA-N.
| Molecular formula | C6H3Br2NO2 |
|---|---|
| Molecular weight | 280.90 g/mol |
| IUPAC name | 1,2-dibromo-4-nitrobenzene |
| InChIKey | DLLDRYLYVHKDKK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])Br)Br |
Computed by PubChem (NCBI)