CAS 5418-11-1 appears in our catalog under these names: (2-(Phenylsulfonyl)vinyl)benzene, 98%, Phenyl trans-styryl sulfone, 95%. Offered by: AmBeed, Fluorochem. Available pack sizes: 5g, 1g, 25g, 100g.
[(E)-2-(benzenesulfonyl)ethenyl]benzene (CAS 5418-11-1) is a chemical compound with the molecular formula C14H12O2S and a molecular weight of 244.31 g/mol. IUPAC name: [(E)-2-(benzenesulfonyl)ethenyl]benzene. InChIKey: DNMCCXFLTURVLK-VAWYXSNFSA-N.
| Molecular formula | C14H12O2S |
|---|---|
| Molecular weight | 244.31 g/mol |
| IUPAC name | [(E)-2-(benzenesulfonyl)ethenyl]benzene |
| InChIKey | DNMCCXFLTURVLK-VAWYXSNFSA-N |
| SMILES | C1=CC=C(C=C1)/C=C/S(=O)(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)