Products 5515-82-2
CAS 5515-82-2 is the registry number for 5-O-Cinnamoylquinic acid. Offered by: MedChemExpress. Available pack sizes: 5mg, 25mg, 10mg.
(1S,3S,4R,5S)-1,3,4-trihydroxy-5-[(E)-3-phenylprop-2-enoyl]oxycyclohexane-1-carboxylic acid (CAS 5515-82-2) is a chemical compound with the molecular formula C16H18O7 and a molecular weight of 322.31 g/mol. IUPAC name: (1S,3S,4R,5S)-1,3,4-trihydroxy-5-[(E)-3-phenylprop-2-enoyl]oxycyclohexane-1-carboxylic acid. InChIKey: WTMHIVNZOSRKJU-MUMPLMHTSA-N.
| Molecular formula | C16H18O7 |
|---|---|
| Molecular weight | 322.31 g/mol |
| IUPAC name | (1S,3S,4R,5S)-1,3,4-trihydroxy-5-[(E)-3-phenylprop-2-enoyl]oxycyclohexane-1-carboxylic acid |
| InChIKey | WTMHIVNZOSRKJU-MUMPLMHTSA-N |
| SMILES | C1[C@@H]([C@H]([C@H](C[C@@]1(C(=O)O)O)OC(=O)/C=C/C2=CC=CC=C2)O)O |
Computed by PubChem (NCBI)