CAS 553636-63-8 appears in our catalog under these names: 2-(3-Methyl-2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl)benzoic acid, 95%, 2-(3-Methyl-2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl)benzoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
2-(3-methyl-2,5-dioxopyrrol-1-yl)benzoic acid (CAS 553636-63-8) is a chemical compound with the molecular formula C12H9NO4 and a molecular weight of 231.20 g/mol. IUPAC name: 2-(3-methyl-2,5-dioxopyrrol-1-yl)benzoic acid. InChIKey: FGRSEKUPERCZCN-UHFFFAOYSA-N.
| Molecular formula | C12H9NO4 |
|---|---|
| Molecular weight | 231.20 g/mol |
| IUPAC name | 2-(3-methyl-2,5-dioxopyrrol-1-yl)benzoic acid |
| InChIKey | FGRSEKUPERCZCN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)N(C1=O)C2=CC=CC=C2C(=O)O |
Computed by PubChem (NCBI)