Products 556808-97-0
CAS 556808-97-0 is the registry number for (E)-6-Chloro-4-(1-methoxyethylidene)-2-methyl-1,4-dihydroisoquinolin-3(2H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(4E)-6-chloro-4-(1-methoxyethylidene)-2-methyl-1H-isoquinolin-3-one (CAS 556808-97-0) is a chemical compound with the molecular formula C13H14ClNO2 and a molecular weight of 251.71 g/mol. IUPAC name: (4E)-6-chloro-4-(1-methoxyethylidene)-2-methyl-1H-isoquinolin-3-one. InChIKey: MOUGGOPZNLTCFV-XYOKQWHBSA-N.
| Molecular formula | C13H14ClNO2 |
|---|---|
| Molecular weight | 251.71 g/mol |
| IUPAC name | (4E)-6-chloro-4-(1-methoxyethylidene)-2-methyl-1H-isoquinolin-3-one |
| InChIKey | MOUGGOPZNLTCFV-XYOKQWHBSA-N |
| SMILES | C/C(=C\1/C2=C(CN(C1=O)C)C=CC(=C2)Cl)/OC |
Computed by PubChem (NCBI)