CAS 557798-56-8 appears in our catalog under these names: Methyl 2-bromo-2-(3,4-difluorophenyl)acetate, 95%, Methyl 2-bromo-2-(3,4-difluorophenyl)acetate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
Methyl 2-bromo-2-(3,4-difluorophenyl)acetate (CAS 557798-56-8) is a chemical compound with the molecular formula C9H7BrF2O2 and a molecular weight of 265.05 g/mol. IUPAC name: methyl 2-bromo-2-(3,4-difluorophenyl)acetate. InChIKey: UTXQGMIDBWDOCU-UHFFFAOYSA-N.
| Molecular formula | C9H7BrF2O2 |
|---|---|
| Molecular weight | 265.05 g/mol |
| IUPAC name | methyl 2-bromo-2-(3,4-difluorophenyl)acetate |
| InChIKey | UTXQGMIDBWDOCU-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C1=CC(=C(C=C1)F)F)Br |
Computed by PubChem (NCBI)