Products 568551-28-0
CAS 568551-28-0 appears in our catalog under these names: 1-(4-Chloro-2-methoxy-5-methyl-phenyl)-pyrrole-2,5-dione, 95%, 1-(4-Chloro-2-methoxy-5-methylphenyl)-2,5-dihydro-1H-pyrrole-2,5-dione. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g.
1-(4-chloro-2-methoxy-5-methylphenyl)pyrrole-2,5-dione (CAS 568551-28-0) is a chemical compound with the molecular formula C12H10ClNO3 and a molecular weight of 251.66 g/mol. IUPAC name: 1-(4-chloro-2-methoxy-5-methylphenyl)pyrrole-2,5-dione. InChIKey: MLCLPRDEYYUNCY-UHFFFAOYSA-N.
| Molecular formula | C12H10ClNO3 |
|---|---|
| Molecular weight | 251.66 g/mol |
| IUPAC name | 1-(4-chloro-2-methoxy-5-methylphenyl)pyrrole-2,5-dione |
| InChIKey | MLCLPRDEYYUNCY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1Cl)OC)N2C(=O)C=CC2=O |
Computed by PubChem (NCBI)