CAS 56881-09-5 is the registry number for Hydroxychloroquine Sulfate Impurity 21. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
Ethyl 5-chloro-4-oxo-1H-quinoline-3-carboxylate (CAS 56881-09-5) is a chemical compound with the molecular formula C12H10ClNO3 and a molecular weight of 251.66 g/mol. IUPAC name: ethyl 5-chloro-4-oxo-1H-quinoline-3-carboxylate. InChIKey: VHVLAELLXHZNJT-UHFFFAOYSA-N.
| Molecular formula | C12H10ClNO3 |
|---|---|
| Molecular weight | 251.66 g/mol |
| IUPAC name | ethyl 5-chloro-4-oxo-1H-quinoline-3-carboxylate |
| InChIKey | VHVLAELLXHZNJT-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CNC2=C(C1=O)C(=CC=C2)Cl |
Computed by PubChem (NCBI)