Products 5768-34-3
CAS 5768-34-3 appears in our catalog under these names: 4-(2-Furoylamino)benzoic acid, 95%, 4-(Furan-2-carboxamido)benzoic acid, 98%, 98%, 4-(Furan-2-carboxamido)benzoic acid, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 10g, 100mg.
4-(furan-2-carbonylamino)benzoic acid (CAS 5768-34-3) is a chemical compound with the molecular formula C12H9NO4 and a molecular weight of 231.20 g/mol. IUPAC name: 4-(furan-2-carbonylamino)benzoic acid. InChIKey: LKSXLVUUFLNDSS-UHFFFAOYSA-N.
| Molecular formula | C12H9NO4 |
|---|---|
| Molecular weight | 231.20 g/mol |
| IUPAC name | 4-(furan-2-carbonylamino)benzoic acid |
| InChIKey | LKSXLVUUFLNDSS-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)C(=O)NC2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)