Products 58073-67-9
CAS 58073-67-9 appears in our catalog under these names: Pilocarpine Impurity 4, (3R,4S)-4-Ethyltetrahydro-5-oxo-3-furanacetic Acid. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 10mg.
2-[(3R,4S)-4-ethyl-5-oxooxolan-3-yl]acetic acid (CAS 58073-67-9) is a chemical compound with the molecular formula C8H12O4 and a molecular weight of 172.18 g/mol. IUPAC name: 2-[(3R,4S)-4-ethyl-5-oxooxolan-3-yl]acetic acid. InChIKey: AQARPLAIJXEEPY-WDSKDSINSA-N.
| Molecular formula | C8H12O4 |
|---|---|
| Molecular weight | 172.18 g/mol |
| IUPAC name | 2-[(3R,4S)-4-ethyl-5-oxooxolan-3-yl]acetic acid |
| InChIKey | AQARPLAIJXEEPY-WDSKDSINSA-N |
| SMILES | CC[C@H]1[C@H](COC1=O)CC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
(3R,4S)-4-Ethyltetrahydro-5-oxo-3-furanacetic acid, Pilocarpine Impurity 6, (+)-Homopilopic acid, (+/-)-Homopilopic acid, (3R,4S)-Homopilopic acid, cis-4-Ethyltetrahydro-5-oxo-3-furanacetic acid, [(3R,4S)-4-Ethyl-5-oxooxolan-3-yl]acetic acid, 4-Ethyltetrahydro-5-oxo-3-furanacetic acid, cis-, 4-Ethyltetrahydro-5-oxo-3-furanacetic acid, (3R,4S)-, 3-Furanacetic acid, 4-ethyltetrahydro-5-oxo-, (3R,4S)-