Products 58298-77-4
CAS 58298-77-4 is the registry number for Agaridoxin. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2S)-2-amino-5-(3,4-dihydroxyanilino)-5-oxopentanoic acid (CAS 58298-77-4) is a chemical compound with the molecular formula C11H14N2O5 and a molecular weight of 254.24 g/mol. IUPAC name: (2S)-2-amino-5-(3,4-dihydroxyanilino)-5-oxopentanoic acid. InChIKey: HJLNKWYSKFDHDG-ZETCQYMHSA-N.
| Molecular formula | C11H14N2O5 |
|---|---|
| Molecular weight | 254.24 g/mol |
| IUPAC name | (2S)-2-amino-5-(3,4-dihydroxyanilino)-5-oxopentanoic acid |
| InChIKey | HJLNKWYSKFDHDG-ZETCQYMHSA-N |
| SMILES | C1=CC(=C(C=C1NC(=O)CC[C@@H](C(=O)O)N)O)O |
Computed by PubChem (NCBI)