CAS 58584-86-4 appears in our catalog under these names: Ethyl 2,6–Dichloronicotinate, Ethyl 2,6-Dichloronicotinate, >98.0%(GC), Ethyl 2,6-dichloronicotinate 95%, 3-Pyridinecarboxylic acid, 2,6-dichloro-, ethyl ester, 95%, 95%, Ethyl 2,6-dichloronicotinate, 97%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 10g, 25g, 100g, 500g.
Ethyl 2,6-dichloropyridine-3-carboxylate (CAS 58584-86-4) is a chemical compound with the molecular formula C8H7Cl2NO2 and a molecular weight of 220.05 g/mol. IUPAC name: ethyl 2,6-dichloropyridine-3-carboxylate. InChIKey: KKYBVLDQTWQETN-UHFFFAOYSA-N.
| Molecular formula | C8H7Cl2NO2 |
|---|---|
| Molecular weight | 220.05 g/mol |
| IUPAC name | ethyl 2,6-dichloropyridine-3-carboxylate |
| InChIKey | KKYBVLDQTWQETN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)