CAS 58607-24-2 appears in our catalog under these names: Tetramethyl-1,4-dioxane-2,6-dione, 95%, Tetramethyl-1,4-dioxane-2,6-dione. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
3,3,5,5-tetramethyl-1,4-dioxane-2,6-dione (CAS 58607-24-2) is a chemical compound with the molecular formula C8H12O4 and a molecular weight of 172.18 g/mol. IUPAC name: 3,3,5,5-tetramethyl-1,4-dioxane-2,6-dione. InChIKey: CGVYQNFYKAABLQ-UHFFFAOYSA-N.
| Molecular formula | C8H12O4 |
|---|---|
| Molecular weight | 172.18 g/mol |
| IUPAC name | 3,3,5,5-tetramethyl-1,4-dioxane-2,6-dione |
| InChIKey | CGVYQNFYKAABLQ-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)OC(=O)C(O1)(C)C)C |
Computed by PubChem (NCBI)