CAS 59301-25-6 is the registry number for 5-(2-Bromophenyl)-4H-1,2,4-triazol-3-amine. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
5-(2-bromophenyl)-1H-1,2,4-triazol-3-amine (CAS 59301-25-6) is a chemical compound with the molecular formula C8H7BrN4 and a molecular weight of 239.07 g/mol. IUPAC name: 5-(2-bromophenyl)-1H-1,2,4-triazol-3-amine. InChIKey: CXRHBUWCLZAXAC-UHFFFAOYSA-N.
| Molecular formula | C8H7BrN4 |
|---|---|
| Molecular weight | 239.07 g/mol |
| IUPAC name | 5-(2-bromophenyl)-1H-1,2,4-triazol-3-amine |
| InChIKey | CXRHBUWCLZAXAC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NC(=NN2)N)Br |
Computed by PubChem (NCBI)