CAS 60468-36-2 appears in our catalog under these names: 2-Chloro-2',5'-difluoroacetophenone - 90%, 2-Chloro-2',5'-difluoroacetophenone 98%, 2-Chloro-2',5'-Difluoroacetophenone, 98%, 98%, 2-Chloro-1-(2,5-difluorophenyl)ethanone, 98%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 250g, 100g, 5g, 25g, 500g, 1g, 50g.
2-chloro-1-(2,5-difluorophenyl)ethanone (CAS 60468-36-2) is a chemical compound with the molecular formula C8H5ClF2O and a molecular weight of 190.57 g/mol. IUPAC name: 2-chloro-1-(2,5-difluorophenyl)ethanone. InChIKey: HJWDDTDVBUFTCP-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF2O |
|---|---|
| Molecular weight | 190.57 g/mol |
| IUPAC name | 2-chloro-1-(2,5-difluorophenyl)ethanone |
| InChIKey | HJWDDTDVBUFTCP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)C(=O)CCl)F |
Computed by PubChem (NCBI)