CAS 6050-80-2 appears in our catalog under these names: 2H,3H–Naphtho(1,2–b)furan–2–one, 2H,3H-Naphtho(1,2-b)furan-2-one, 2H,3H-Naphtho[1,2-b]furan-2-one 95%. Offered by: GLPBio, Biosynth, Ambeed. Available pack sizes: 50mg, 2,5g, 250mg, 100mg, 1g.
3H-benzo[g][1]benzofuran-2-one (CAS 6050-80-2) is a chemical compound with the molecular formula C12H8O2 and a molecular weight of 184.19 g/mol. IUPAC name: 3H-benzo[g][1]benzofuran-2-one. InChIKey: YXVNSYLJLOZDBQ-UHFFFAOYSA-N.
| Molecular formula | C12H8O2 |
|---|---|
| Molecular weight | 184.19 g/mol |
| IUPAC name | 3H-benzo[g][1]benzofuran-2-one |
| InChIKey | YXVNSYLJLOZDBQ-UHFFFAOYSA-N |
| SMILES | C1C2=C(C3=CC=CC=C3C=C2)OC1=O |
Computed by PubChem (NCBI)