CAS 614-90-4 is the registry number for Tolylene 2,5-diisocyanate, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1,4-diisocyanato-2-methylbenzene (CAS 614-90-4) is a chemical compound with the molecular formula C9H6N2O2 and a molecular weight of 174.16 g/mol. IUPAC name: 1,4-diisocyanato-2-methylbenzene. InChIKey: DKBHJZFJCDOGOY-UHFFFAOYSA-N.
| Molecular formula | C9H6N2O2 |
|---|---|
| Molecular weight | 174.16 g/mol |
| IUPAC name | 1,4-diisocyanato-2-methylbenzene |
| InChIKey | DKBHJZFJCDOGOY-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)N=C=O)N=C=O |
Computed by PubChem (NCBI)