CAS 61775-25-5 is the registry number for 3-Phenoxybenzoyl Cyanide. Offered by: TRC. Available pack sizes: 10g.
3-phenoxybenzoyl cyanide (CAS 61775-25-5) is a chemical compound with the molecular formula C14H9NO2 and a molecular weight of 223.23 g/mol. IUPAC name: 3-phenoxybenzoyl cyanide. InChIKey: RBJUQCDEOCYPBM-UHFFFAOYSA-N.
| Molecular formula | C14H9NO2 |
|---|---|
| Molecular weight | 223.23 g/mol |
| IUPAC name | 3-phenoxybenzoyl cyanide |
| InChIKey | RBJUQCDEOCYPBM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=CC(=C2)C(=O)C#N |
Computed by PubChem (NCBI)