Products 61942-64-1
CAS 61942-64-1 appears in our catalog under these names: 6-Bromo-2,3-dihydro-1lambda6-benzothiophene-1,1-dione, 6-Bromo-2,3-dihydrobenzo(b)thiophene 1,1-dioxide, 95%, 6-​Bromo-​2,​3-​dihydro-​benzo(b)​thiophene 1,​1-​dioxide. Offered by: TRC, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 0,5g, 50mg.
6-bromo-2,3-dihydro-1-benzothiophene 1,1-dioxide (CAS 61942-64-1) is a chemical compound with the molecular formula C8H7BrO2S and a molecular weight of 247.11 g/mol. IUPAC name: 6-bromo-2,3-dihydro-1-benzothiophene 1,1-dioxide. InChIKey: FUHDZKNBAPRMHD-UHFFFAOYSA-N.
| Molecular formula | C8H7BrO2S |
|---|---|
| Molecular weight | 247.11 g/mol |
| IUPAC name | 6-bromo-2,3-dihydro-1-benzothiophene 1,1-dioxide |
| InChIKey | FUHDZKNBAPRMHD-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)C2=C1C=CC(=C2)Br |
Computed by PubChem (NCBI)