Products 62068-78-4
CAS 62068-78-4 appears in our catalog under these names: 2,6–Dichloropyridine–3–carboxamide, 2,6-Dichloropyridine-3-carboxamide, 2,6-Dichloronicotinamide 97%, 2,6-Dichloronicotinamide, 97%, 97%, 2,6-Dichloronicotinamide, 98%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 2,5g, 0,25g, 250mg, 100g, 10g.
2,6-dichloropyridine-3-carboxamide (CAS 62068-78-4) is a chemical compound with the molecular formula C6H4Cl2N2O and a molecular weight of 191.01 g/mol. IUPAC name: 2,6-dichloropyridine-3-carboxamide. InChIKey: TZQZNPXAAMVOKE-UHFFFAOYSA-N.
| Molecular formula | C6H4Cl2N2O |
|---|---|
| Molecular weight | 191.01 g/mol |
| IUPAC name | 2,6-dichloropyridine-3-carboxamide |
| InChIKey | TZQZNPXAAMVOKE-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1C(=O)N)Cl)Cl |
Computed by PubChem (NCBI)