Products 62353-39-3
CAS 62353-39-3 is the registry number for 5-(Chloromethyl)-3-(4-chlorophenyl)-4,5-dihydro-1,2-oxazole. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-(chloromethyl)-3-(4-chlorophenyl)-4,5-dihydro-1,2-oxazole (CAS 62353-39-3) is a chemical compound with the molecular formula C10H9Cl2NO and a molecular weight of 230.09 g/mol. IUPAC name: 5-(chloromethyl)-3-(4-chlorophenyl)-4,5-dihydro-1,2-oxazole. InChIKey: GHCJAMIKIJZDLV-UHFFFAOYSA-N.
| Molecular formula | C10H9Cl2NO |
|---|---|
| Molecular weight | 230.09 g/mol |
| IUPAC name | 5-(chloromethyl)-3-(4-chlorophenyl)-4,5-dihydro-1,2-oxazole |
| InChIKey | GHCJAMIKIJZDLV-UHFFFAOYSA-N |
| SMILES | C1C(ON=C1C2=CC=C(C=C2)Cl)CCl |
Computed by PubChem (NCBI)