Products 62423-71-6
CAS 62423-71-6 is the registry number for Salbutamol Impurity 114. Offered by: Chemat Brand. Available pack sizes: on request.
5-(2-bromoacetyl)-2-hydroxybenzoic acid (CAS 62423-71-6) is a chemical compound with the molecular formula C9H7BrO4 and a molecular weight of 259.05 g/mol. IUPAC name: 5-(2-bromoacetyl)-2-hydroxybenzoic acid. InChIKey: AWCZHDQYNKDRCC-UHFFFAOYSA-N.
| Molecular formula | C9H7BrO4 |
|---|---|
| Molecular weight | 259.05 g/mol |
| IUPAC name | 5-(2-bromoacetyl)-2-hydroxybenzoic acid |
| InChIKey | AWCZHDQYNKDRCC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)CBr)C(=O)O)O |
Computed by PubChem (NCBI)
Synonyms:
5-(2-bromoacetyl)-2-hydroxybenzoic acid, 5-(Bromoacetyl)-2-hydroxybenzoic acid, 5-(2-bromoacetyl)-2-hydroxy-benzoic acid, Benzoic acid, 5-(bromoacetyl)-2-hydroxy-, Salbutamol Impurity 114, AWCZHDQYNKDRCC-UHFFFAOYSA-N, 2-hydroxy-5-(2-bromoacetyl)benzoic acid, 2-hydroxy-5-(alpha-bromoacetyl) benzoic acid