CAS 6249-56-5 appears in our catalog under these names: gamma-Butyrobetaine Hydrochloride, >95% (HPLC), (3-Carboxypropyl)trimethylammonium chloride/ 99.97% (existing batch purity), gamma-Butyrobetaine hydrochloride, (3-Carboxypropyl)trimethylammonium chloride 97%, (3-CARBOXYPROPYL)TRIMETHYLAMMONIUM CHLOR. Offered by: TRC, TargetMol, Biosynth, Ambeed, Sigma-Aldrich. Available pack sizes: 10g, 1g, 100mg, 0,025kg, 0,05kg, 0,1kg, 0,5kg, 0,25kg.
3-carboxypropyl(trimethyl)azanium chloride (CAS 6249-56-5) is a chemical compound with the molecular formula C7H16ClNO2 and a molecular weight of 181.66 g/mol. IUPAC name: 3-carboxypropyl(trimethyl)azanium chloride. InChIKey: GNRKTORAJTTYIW-UHFFFAOYSA-N.
| Molecular formula | C7H16ClNO2 |
|---|---|
| Molecular weight | 181.66 g/mol |
| IUPAC name | 3-carboxypropyl(trimethyl)azanium chloride |
| InChIKey | GNRKTORAJTTYIW-UHFFFAOYSA-N |
| SMILES | C[N+](C)(C)CCCC(=O)O.[Cl-] |
Computed by PubChem (NCBI)