Products 85806-17-3
CAS 85806-17-3 appears in our catalog under these names: Gamma-Butyrobetaine-d9 Hydrochloride, >95% (HPLC), N-(Carboxypropyl)-N,N,N-trimethyl-d9-ammonium Chloride, 99 atom % D, min 98% Chemical Purity, Actinine-d9 (chloride), 98.01%. Offered by: TRC, CDN, MedChemExpress. Available pack sizes: 50mg, 5mg, 0,05g, 0,01g, 10 mg, 1 mg, 5 mg.
4-[tris(trideuteriomethyl)azaniumyl]butanoate;hydrochloride (CAS 85806-17-3) is a chemical compound with the molecular formula C7H16ClNO2 and a molecular weight of 190.71 g/mol. IUPAC name: 4-[tris(trideuteriomethyl)azaniumyl]butanoate;hydrochloride. InChIKey: GNRKTORAJTTYIW-KYRNGWDOSA-N.
| Molecular formula | C7H16ClNO2 |
|---|---|
| Molecular weight | 190.71 g/mol |
| IUPAC name | 4-[tris(trideuteriomethyl)azaniumyl]butanoate;hydrochloride |
| InChIKey | GNRKTORAJTTYIW-KYRNGWDOSA-N |
| SMILES | [2H]C([2H])([2H])[N+](CCCC(=O)[O-])(C([2H])([2H])[2H])C([2H])([2H])[2H].Cl |
Computed by PubChem (NCBI)