Products 68040-76-6

CAS 68040-76-6 is the registry number for 2-(3-Carboxyprop-2-enoylamino)benzoic acid. Offered by: Biosynth. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

2-(3-carboxyprop-2-enoylamino)benzoic acid (CAS 68040-76-6) is a chemical compound with the molecular formula C11H9NO5 and a molecular weight of 235.19 g/mol. IUPAC name: 2-(3-carboxyprop-2-enoylamino)benzoic acid. InChIKey: QRJVIZCSCVUXBG-UHFFFAOYSA-N.

Identity
Molecular formulaC11H9NO5
Molecular weight235.19 g/mol
IUPAC name2-(3-carboxyprop-2-enoylamino)benzoic acid
InChIKeyQRJVIZCSCVUXBG-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)C(=O)O)NC(=O)C=CC(=O)O

Computed by PubChem (NCBI)

Synonyms: IFLab1_003970