CAS 62827-49-0 appears in our catalog under these names: 2-Bromo-4,6-dimethoxybenzoic acid, 97%, 2-Bromo-4,6-dimethoxybenzoic acid, 2-Bromo-4,6-dimethoxybenzoic acid, 95%, 95%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 250mg.
2-bromo-4,6-dimethoxybenzoic acid (CAS 62827-49-0) is a chemical compound with the molecular formula C9H9BrO4 and a molecular weight of 261.07 g/mol. IUPAC name: 2-bromo-4,6-dimethoxybenzoic acid. InChIKey: JSRIGQZZKGUUTK-UHFFFAOYSA-N.
| Molecular formula | C9H9BrO4 |
|---|---|
| Molecular weight | 261.07 g/mol |
| IUPAC name | 2-bromo-4,6-dimethoxybenzoic acid |
| InChIKey | JSRIGQZZKGUUTK-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1)Br)C(=O)O)OC |
Computed by PubChem (NCBI)