CAS 6286-46-0 appears in our catalog under these names: 2-Bromo-4,5-dimethoxybenzoic Acid, 2–Bromo–4,5–dimethoxybenzoic Acid, 2-Bromo-4,5-dimethoxybenzoic Acid, >98.0%(HPLC)(T), 2-Bromo-4,5-dimethoxybenzoic acid 98%, 2-BROMO-4,5-DIMETHOXYBENZOIC ACID, 98%. Offered by: TRC, GLPBio, TCI, Biosynth, Ambeed. Available pack sizes: 100g, 25g, 5g, 1g, 5000g, 10g, 500g, 15g.
2-bromo-4,5-dimethoxybenzoic acid (CAS 6286-46-0) is a chemical compound with the molecular formula C9H9BrO4 and a molecular weight of 261.07 g/mol. IUPAC name: 2-bromo-4,5-dimethoxybenzoic acid. InChIKey: HWFCHCRFQWEFMU-UHFFFAOYSA-N.
| Molecular formula | C9H9BrO4 |
|---|---|
| Molecular weight | 261.07 g/mol |
| IUPAC name | 2-bromo-4,5-dimethoxybenzoic acid |
| InChIKey | HWFCHCRFQWEFMU-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)C(=O)O)Br)OC |
Computed by PubChem (NCBI)