CAS 6296-53-3 appears in our catalog under these names: 3–Acetamidophthalic Anhydride, 3-Acetamidophthalic anhydride, 3-Acetylaminophthalic Anhydride 97%, 3-Acetamidophthalic anhydride, 99.98%, 3-Acetamidophthalic Anhydride, >98.0%(GC)(T). Offered by: GLPBio, Biosynth, Ambeed, MedChemExpress, TCI. Available pack sizes: 25g, 5g, 2g, 10g, 1g, 100g, 500g, 100 g.
N-(1,3-dioxo-2-benzofuran-4-yl)acetamide (CAS 6296-53-3) is a chemical compound with the molecular formula C10H7NO4 and a molecular weight of 205.17 g/mol. IUPAC name: N-(1,3-dioxo-2-benzofuran-4-yl)acetamide. InChIKey: PAUAJOABXCGLCN-UHFFFAOYSA-N.
| Molecular formula | C10H7NO4 |
|---|---|
| Molecular weight | 205.17 g/mol |
| IUPAC name | N-(1,3-dioxo-2-benzofuran-4-yl)acetamide |
| InChIKey | PAUAJOABXCGLCN-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC=CC2=C1C(=O)OC2=O |
Computed by PubChem (NCBI)